Online Database of Chemicals from Around the World
|
CAS#: 7724-41-6 Product: (8S)-4-Deoxytetrodotoxin No suppilers available for the product. |
| Name | (8S)-4-Deoxytetrodotoxin |
|---|---|
| Synonyms | Deoxytetrodotoxin; Desoxytetrodotoxin; Tetrodotoxin, 4-Deoxy- |
| Molecular Structure |  |
| Molecular Formula | C11H17N3O7 |
| Molecular Weight | 303.27 |
| CAS Registry Number | 7724-41-6 |
| SMILES | [C@H]12C4(NC(=NC1)N)C(O)(C3(OC2C(O)C(O3)C4O)O)CO |
| InChI | 1S/C11H17N3O7/c12-8-13-1-3-5-4(16)6-7(17)10(3,14-8)9(18,2-15)11(19,20-5)21-6/h3-7,15-19H,1-2H2,(H3,12,13,14)/t3-,4?,5?,6?,7?,9?,10?,11?/m0/s1 |
| InChIKey | COVOMQKTVSVWBZ-CJCGOCGYSA-N |
| Density | 2.584g/cm3 (Cal.) |
|---|---|
| Boiling point | 693.039°C at 760 mmHg (Cal.) |
| Flash point | 372.937°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (8S)-4-Deoxytetrodotoxin |