Online Database of Chemicals from Around the World
| Name | 4-Bromo-N,N-Dimethyl-2,2-Diphenylbutanamide |
|---|---|
| Synonyms | 4-Brom-N,N-dimethyl-2,2-diphenylbutanamid; 4-Bromo-N,N-dimethyl-2,2-diphenylbutanamide; 4-Bromo-N,N-diméthyl-2,2-diphénylbutanamide |
| Molecular Structure |  |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.26 |
| CAS Registry Number | 113817-55-3 |
| SMILES | CN(C)C(=O)C(CCBr)(c1ccccc1)c2ccccc2 |
| InChI | 1S/C18H20BrNO/c1-20(2)17(21)18(13-14-19,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | GTQMKRZWRROSKH-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 215.3±28.7°C (Cal.) |
| Refractive index | 1.58 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-N,N-Dimethyl-2,2-Diphenylbutanamide |
