| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| PepTech Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (781) 273-5400 | |||
![]() |
service@peptechcorp.com | |||
| Chemical manufacturer | ||||
| Watanabe Chemical Ind., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() |
+81 (82) 231-0540 | |||
![]() |
inquiry@watanabechem.co.jp | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> BOC-amino acid |
|---|---|
| Name | 5-Bromo-alpha-[[(1,1-Dimethylethoxy)Carbonyl]Amino]-(alphaS)-2-Thiophenepropanoicacid |
| Synonyms | (2S)-3-(5-Bromo-2-Thienyl)-2-(Tert-Butoxycarbonylamino)Propanoate; (2S)-3-(5-Bromo-2-Thienyl)-2-[(Tert-Butoxy-Oxomethyl)Amino]Propanoate; (2S)-3-(5-Bromo-2-Thienyl)-2-(Tert-Butoxycarbonylamino)Propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15BrNO4S |
| Molecular Weight | 349.22 |
| CAS Registry Number | 190319-95-0 |
| SMILES | [C@H](NC(OC(C)(C)C)=O)(CC1=CC=C(Br)S1)C([O-])=O |
| InChI | 1S/C12H16BrNO4S/c1-12(2,3)18-11(17)14-8(10(15)16)6-7-4-5-9(13)19-7/h4-5,8H,6H2,1-3H3,(H,14,17)(H,15,16)/p-1/t8-/m0/s1 |
| InChIKey | HHNNFRCLMQFXBA-QMMMGPOBSA-M |
| Boiling point | 473.822°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 240.359°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-alpha-[[(1,1-Dimethylethoxy)Carbonyl]Amino]-(alphaS)-2-Thiophenepropanoicacid |