|
CAS#: 114828-89-6 Product: 6,7-Dinitro-2,3-Quinoxalinedione No suppilers available for the product. |
| Name | 6,7-Dinitro-2,3-Quinoxalinedione |
|---|---|
| Synonyms | DiR; DNQ; DNQX |
| Molecular Structure | ![]() |
| Molecular Formula | C8H2N4O6 |
| Molecular Weight | 250.12 |
| CAS Registry Number | 114828-89-6 |
| SMILES | C1=C(C(=CC2=NC(=O)C(=O)N=C21)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C8H2N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H |
| InChIKey | YEUPBRRGMWBCEB-UHFFFAOYSA-N |
| Density | 2.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.5±52.0°C at 760 mmHg (Cal.) |
| Flash point | 142.8±30.7°C (Cal.) |
| Refractive index | 1.855 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dinitro-2,3-Quinoxalinedione |