Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Astatech, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (215) 785-3197 | |||
|
sales@astatechinc.com | |||
| Chemical manufacturer since 1996 | ||||
| Name | 3,6-Dinitro-4-quinolinol |
|---|---|
| Synonyms | 3,6-Dinitro-4-hydroxyquinoline; 3,6-Dinitro-quinolin-4-ol; 4-QUINOLINOL,3,6-DINITRO- |
| Molecular Structure |  |
| Molecular Formula | C9H5N3O5 |
| Molecular Weight | 235.15 |
| CAS Registry Number | 874499-33-9 |
| SMILES | O=N(=O)c1ccc2ncc(c(O)c2c1)N(=O)=O |
| InChI | 1S/C9H5N3O5/c13-9-6-3-5(11(14)15)1-2-7(6)10-4-8(9)12(16)17/h1-4H,(H,10,13) |
| InChIKey | YOFJDNXGWZPDCB-UHFFFAOYSA-N |
| Density | 1.693g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.416°C at 760 mmHg (Cal.) |
| Flash point | 212.899°C (Cal.) |
| Refractive index | 1.76 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Dinitro-4-quinolinol |