|
CAS#: 115459-65-9 Product: (2S)-(+)-Glycidyl 4-Nitrobenzoate No suppilers available for the product. |
| Name | (2S)-(+)-Glycidyl 4-Nitrobenzoate |
|---|---|
| Synonyms | 4-Nitrobenzoic Acid [(2S)-2-Oxiranyl]Methyl Ester; 4-Nitrobenzoic Acid Glycidyl Ester; (2S)-()-Glycidyl 4-Nitrobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 |
| CAS Registry Number | 115459-65-9 |
| SMILES | [C@@H]1(OC1)COC(=O)C2=CC=C([N+]([O-])=O)C=C2 |
| InChI | 1S/C10H9NO5/c12-10(16-6-9-5-15-9)7-1-3-8(4-2-7)11(13)14/h1-4,9H,5-6H2/t9-/m0/s1 |
| InChIKey | MUWIANZPEBMVHH-VIFPVBQESA-N |
| Density | 1.399g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.28°C at 760 mmHg (Cal.) |
| Flash point | 187.483°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S)-(+)-Glycidyl 4-Nitrobenzoate |