Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (386) 462-0788 | |||
|
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 4,4'-[(2,2-Dimethyl-1,3-Propanediyl)Bis(Oxy)]Dianiline |
|---|---|
| Synonyms | 1,3'-Bis(4-aminophenoxy)-2,2-dimethylpropane; 4-[3-(4-Aminophenoxy)-2,2-dimethylpropoxy]aniline; MFCD00671569 |
| Molecular Structure | ![CAS#: 115570-52-0， 4,4'-[(2,2-Dimethyl-1,3-Propanediyl)Bis(Oxy)]Dianiline](/moreStructures/115570-52-0.gif) |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 |
| CAS Registry Number | 115570-52-0 |
| SMILES | Nc1ccc(cc1)OCC(C)(C)COc2ccc(N)cc2 |
| InChI | 1S/C17H22N2O2/c1-17(2,11-20-15-7-3-13(18)4-8-15)12-21-16-9-5-14(19)6-10-16/h3-10H,11-12,18-19H2,1-2H3 |
| InChIKey | HPUJEBAZZTZOFL-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Melting point | 116°C (Expl.) |
| Boiling point | 472.899°C at 760 mmHg (Cal.) |
| Flash point | 255.903°C (Cal.) |
| Refractive index | 1.598 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-[(2,2-Dimethyl-1,3-Propanediyl)Bis(Oxy)]Dianiline |