Online Database of Chemicals from Around the World
| Name | 4-Nitrofluoranthen-1-Ol |
|---|---|
| Synonyms | 4-Nitro-1-Fluoranthenol; 3-Nitrofluoranthen-6-Ol; Ccris 3449 |
| Molecular Structure |  |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.25 |
| CAS Registry Number | 115664-55-6 |
| SMILES | C1=CC(=C4C3=C1C2=CC=CC=C2C3=C(O)C=C4)[N+]([O-])=O |
| InChI | 1S/C16H9NO3/c18-14-8-6-12-13(17(19)20)7-5-11-9-3-1-2-4-10(9)16(14)15(11)12/h1-8,18H |
| InChIKey | SHZBVUCXEFDDAM-UHFFFAOYSA-N |
| Density | 1.528g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.687°C at 760 mmHg (Cal.) |
| Flash point | 218.297°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrofluoranthen-1-Ol |
