Online Database of Chemicals from Around the World
|
CAS#: 24237-68-1 Product: 4-Nitrofluorene No suppilers available for the product. |
| Name | 4-Nitrofluorene |
|---|---|
| Synonyms | Brn 2973976; Fluorene, 4-Nitro-; 4-05-00-02150 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 |
| CAS Registry Number | 24237-68-1 |
| SMILES | C1=CC=C2C(=C1)CC3=C2C(=CC=C3)[N+]([O-])=O |
| InChI | 1S/C13H9NO2/c15-14(16)12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7H,8H2 |
| InChIKey | CYYBQMPZHMAEGT-UHFFFAOYSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.689°C at 760 mmHg (Cal.) |
| Flash point | 185.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrofluorene |