Online Database of Chemicals from Around the World
|
CAS#: 116200-82-9 Product: Actinoplanone G No suppilers available for the product. |
| Name | Actinoplanone G |
|---|---|
| Synonyms | Actinoplanone G |
| Molecular Structure |  |
| Molecular Formula | C32H30N2O11 |
| Molecular Weight | 618.60 |
| CAS Registry Number | 116200-82-9 |
| SMILES | COC7C1=C(OC4=C(C1=O)C(=O)C5=C2C(=CC3=C(C2=O)C(=O)N(NC(/C)=C(O)/C)C(=C3)C)CC6OCOC4=C56)C(OC)C(O)C7 |
| InChI | 1S/C32H30N2O11/c1-11-6-14-7-15-8-18-21-23(19(15)25(37)20(14)32(40)34(11)33-12(2)13(3)35)27(39)24-26(38)22-17(41-4)9-16(36)28(42-5)30(22)45-31(24)29(21)44-10-43-18/h6-7,16-18,28,33,35-36H,8-10H2,1-5H3/b13-12- |
| InChIKey | WGPBBJROUQQTBF-SEYXRHQNSA-N |
| Density | 1.578g/cm3 (Cal.) |
|---|---|
| Boiling point | 906.416°C at 760 mmHg (Cal.) |
| Flash point | 501.982°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Actinoplanone G |