| Name | 2-Phosphonobenzoic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H7O5P |
| Molecular Weight | 202.10 |
| CAS Registry Number | 116277-67-9 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)P(=O)(O)O |
| InChI | 1S/C7H7O5P/c8-7(9)5-3-1-2-4-6(5)13(10,11)12/h1-4H,(H,8,9)(H2,10,11,12) |
| InChIKey | DQULYJXGTXMNTM-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.3±47.0°C at 760 mmHg (Cal.) |
| Flash point | 253.3±29.3°C (Cal.) |
| Refractive index | 1.62 (Cal.) |
| (1) | Richard Singleton, James Bye, James Dyson, Gary Baker, Robert M. Ranson and Gary B. Hix. Tailoring the photoluminescence properties of transition metal phosphonates, Dalton Trans., 2010, 39, 6024. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Phosphonobenzoic Acid |