Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-[3-(Trifluoromethyl)Phenoxy]Acetone |
|---|---|
| Synonyms | 1-[3-(Trifluormethyl)phenoxy]aceton; 1-[3-(Trifluoromethyl)phenoxy]acetone; 1-[3-(Trifluorométhyl)phénoxy]acétone |
| Molecular Structure | ![CAS#: 117322-88-0， 1-[3-(Trifluoromethyl)Phenoxy]Acetone](/moreStructures/117322-88-0.gif) |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 |
| CAS Registry Number | 117322-88-0 |
| SMILES | CC(=O)COc1cccc(c1)C(F)(F)F |
| InChI | 1S/C10H9F3O2/c1-7(14)6-15-9-4-2-3-8(5-9)10(11,12)13/h2-5H,6H2,1H3 |
| InChIKey | LFGYKNVJPGEVMJ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.1±40.0°C at 760 mmHg (Cal.) |
| Flash point | 98.5±22.2°C (Cal.) |
| Refractive index | 1.446 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(Trifluoromethyl)Phenoxy]Acetone |