Online Database of Chemicals from Around the World
| Name | 4-(Trifluoromethyl)-10H-Phenothiazine |
|---|---|
| Synonyms | 4-(Trifluoromethyl)Phenothiazine; 4-27-00-01359 (Beilstein Handbook Reference); Brn 0239594 |
| Molecular Structure |  |
| Molecular Formula | C13H8F3NS |
| Molecular Weight | 267.27 |
| CAS Registry Number | 343-21-5 |
| SMILES | C1=CC=C2C(=C1)SC3=C(N2)C=CC=C3C(F)(F)F |
| InChI | 1S/C13H8F3NS/c14-13(15,16)8-4-3-6-10-12(8)18-11-7-2-1-5-9(11)17-10/h1-7,17H |
| InChIKey | NSWKFLADKSTFDS-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.619°C at 760 mmHg (Cal.) |
| Flash point | 168.268°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Trifluoromethyl)-10H-Phenothiazine |
