Online Database of Chemicals from Around the World

N-[(5,7-Dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl)carbonyl]-3-(methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride (1:1)
[CAS 1194550-65-6]

List of Suppliers
Hangzhou Cyanochem Co., Ltd. China
www.cyanochem.com
+86 (571) 8522-0831
+86 17788583750
+86 (571) 8522-0831
info@cyanochem.com
QQ Chat
Skype Chat
Chemical manufacturer since 2017
chemBlink Standard supplier since 2018
Shanghai Worldyang Chemical Co., Ltd. China
www.worldyachem.com
+86 13651600618
+86 (21) 5679-5779
+86 (21) 5679-5266
sales7777@worldyachem.com
QQ Chat
WeChat: 13651600618
WhatsApp:+86 13651600618
Chemical manufacturer since 2012

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives
NameN-[(5,7-Dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl)carbonyl]-3-(methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride (1:1)
Synonymsbenzyl (2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-(3-methylsulfonylphenyl)propanoate;hydrochloride
Molecular StructureN-[(5,7-Dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl)carbonyl]-3-(methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride (1:1) molecular structure (CAS 1194550-65-6)
Molecular FormulaC27H26Cl2N2O5S.HCl
Molecular Weight597.94
CAS Registry Number1194550-65-6
EC Number871-600-5
SMILESCS(=O)(=O)C1=CC=CC(=C1)C[C@@H](C(=O)OCC2=CC=CC=C2)NC(=O)C3=C(C=C4CNCCC4=C3Cl)Cl.Cl
Safety Data
Hazard Symbolssymbol symbol   GHS07;GHS08 Warning  Details
Risk StatementsH302-H315-H319-H335-H361  Details
Safety StatementsP203-P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P318-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Acute toxicityAcute Tox.4H302
Eye irritationEye Irrit.2H319
Reproductive toxicityRepr.2H361
Specific target organ toxicity - single exposureSTOT SE3H335
Skin irritationSkin Irrit.2H315
SDSAvailable
up Discovery and Applications
N-[(5,7-Dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl)carbonyl]-3-(methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride (1:1) is a complex organic compound with notable applications in medicinal chemistry and drug development. This molecule integrates a diverse set of functional groups, including an isoquinoline core, a methylsulfonyl group, and a phenylalanine derivative, which together contribute to its potential as a therapeutic agent.

The compound was discovered during research aimed at developing new pharmacological agents with selective biological activities. The core structure, a 5,7-dichloro-1,2,3,4-tetrahydro-6-isoquinoline group, provides a framework known for its biological activity. Isoquinolines are important in drug discovery due to their ability to interact with various biological targets, including receptors and enzymes. The presence of chlorine atoms enhances the molecule's electronic properties and can influence its interaction with biological systems.

The methylsulfonyl group in N-[(5,7-Dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl)carbonyl]-3-(methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride (1:1) plays a critical role in modulating the compound's reactivity and pharmacokinetics. Sulfonyl groups are often used to improve the solubility and stability of drug molecules. Additionally, the phenylalanine derivative acts as a chiral center, which can influence the compound's binding affinity and selectivity for biological targets.

The primary application of this compound lies in its potential as an enzyme inhibitor. The isoquinoline core and the methylsulfonyl group are designed to interact with enzyme active sites, potentially inhibiting their function. Such inhibitors can be crucial in developing treatments for diseases where specific enzymes play a key role, such as cancer or inflammatory disorders. The compound's structure allows it to be tailored for selective inhibition, potentially leading to fewer side effects compared to less specific drugs.

Another area of interest for N-[(5,7-Dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl)carbonyl]-3-(methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride (1:1) is its use in receptor modulation. The compound's ability to interact with various receptors due to its isoquinoline and phenylalanine components makes it a candidate for developing drugs that target specific receptor systems. This could lead to new treatments for a range of conditions, including neurological and psychiatric disorders, where receptor modulation plays a significant role.

The synthesis of this compound involves a series of complex reactions to introduce the various functional groups while preserving the integrity of the isoquinoline core. The use of hydrochloride salt form enhances the compound's solubility and stability, making it suitable for further biological testing and formulation.

In summary, N-[(5,7-Dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl)carbonyl]-3-(methylsulfonyl)-L-phenylalanine phenylmethyl ester hydrochloride (1:1) represents a significant advancement in drug discovery. Its structure provides a versatile framework for developing enzyme inhibitors and receptor modulators, with potential applications in treating a variety of diseases. The ongoing research and development of this compound are expected to yield valuable insights into its therapeutic potential and lead to new pharmaceutical agents.
Market Analysis Reports
Related Products
2,3-Dichlorotet...  3,3-Dichlorotet...  3,3-Dichlorotet...  3,3-Dichlorotet...  1,3-Dichlorotet...  5,7-Dichloro-1,...  5,7-Dichloro-1,...  5,7-Dichloro-1,...  5,7-Dichloro-1,...  7,8-Dichloro-1,...  (5alpha,9alpha,...  7,8-Dichloro-1,...  5,7-Dichloro-1,...  1,4-Dichloro-5,...  2,4-Dichloro-5,...  2,3-Dichlorotet...  3,3-Dichlorotet...  3,4-Dichloro-N-...  2,6-Dichloro-9-...  8,9-Dichloro-2,...