Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(2R,6S)-2,6-Dihydroxycyclohexyl]Ethanone |
|---|---|
| Synonyms | 1-((2R,6S)-2,6-dihydroxycyclohexyl)ethanone |
| Molecular Structure | ![CAS#: 119458-58-1， 1-[(2R,6S)-2,6-Dihydroxycyclohexyl]Ethanone](/moreStructures/119458-58-1.gif) |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 |
| CAS Registry Number | 119458-58-1 |
| SMILES | CC(=O)C1[C@@H](CCC[C@@H]1O)O |
| InChI | 1S/C8H14O3/c1-5(9)8-6(10)3-2-4-7(8)11/h6-8,10-11H,2-4H2,1H3/t6-,7+,8? |
| InChIKey | PSHSTSCQHLHSNL-DHBOJHSNSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.496°C at 760 mmHg (Cal.) |
| Flash point | 152.783°C (Cal.) |
| Refractive index | 1.52 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2R,6S)-2,6-Dihydroxycyclohexyl]Ethanone |