Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(1S,2R)-1,2-Dihydroxycyclohexyl]Ethanone |
|---|---|
| Synonyms | 1-((1S,2R)-1,2-dihydroxycyclohexyl)ethanone |
| Molecular Structure | ![CAS#: 136031-96-4， 1-[(1S,2R)-1,2-Dihydroxycyclohexyl]Ethanone](/moreStructures/136031-96-4.gif) |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 |
| CAS Registry Number | 136031-96-4 |
| SMILES | CC(=O)[C@@]1(CCCC[C@H]1O)O |
| InChI | 1S/C8H14O3/c1-6(9)8(11)5-3-2-4-7(8)10/h7,10-11H,2-5H2,1H3/t7-,8-/m1/s1 |
| InChIKey | XCXITQLIWIIHFX-HTQZYQBOSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.475°C at 760 mmHg (Cal.) |
| Flash point | 129.211°C (Cal.) |
| Refractive index | 1.526 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1S,2R)-1,2-Dihydroxycyclohexyl]Ethanone |