Online Database of Chemicals from Around the World
|
CAS#: 1200-28-8 Product: 1-Chloro-4-Methylsulfonylsulfanylbenzene No suppilers available for the product. |
| Name | 1-Chloro-4-Methylsulfonylsulfanylbenzene |
|---|---|
| Synonyms | 1-Chloro-4-Methylsulfonylsulfanyl-Benzene; 1-Chloro-4-(Methylsulfonylthio)Benzene; 1-Chloro-4-(Mesylthio)Benzene |
| Molecular Structure |  |
| Molecular Formula | C7H7ClO2S2 |
| Molecular Weight | 222.70 |
| CAS Registry Number | 1200-28-8 |
| SMILES | C1=C(S[S](=O)(=O)C)C=CC(=C1)Cl |
| InChI | 1S/C7H7ClO2S2/c1-12(9,10)11-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | HRDUILPJXCHZPN-UHFFFAOYSA-N |
| Density | 1.469g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.729°C at 760 mmHg (Cal.) |
| Flash point | 165.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-Methylsulfonylsulfanylbenzene |