|
CAS#: 68901-09-7 Product: 2-Chloro-5-(Methylsulphamoyl)Benzoic Acid No suppilers available for the product. |
| Name | 2-Chloro-5-(Methylsulphamoyl)Benzoic Acid |
|---|---|
| Synonyms | Zinc03374985 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7ClNO4S |
| Molecular Weight | 248.66 |
| CAS Registry Number | 68901-09-7 |
| EINECS | 272-652-6 |
| SMILES | C1=C([S](=O)(=O)NC)C=CC(=C1C([O-])=O)Cl |
| InChI | 1S/C8H8ClNO4S/c1-10-15(13,14)5-2-3-7(9)6(4-5)8(11)12/h2-4,10H,1H3,(H,11,12)/p-1 |
| InChIKey | RULGDFLFEUYACU-UHFFFAOYSA-M |
| Boiling point | 437.134°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 218.171°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-5-(Methylsulphamoyl)Benzoic Acid |