Online Database of Chemicals from Around the World
|
CAS#: 120314-14-9 Product: 2-(1-Nitrosoindol-3-Yl)Ethanol No suppilers available for the product. |
| Name | 2-(1-Nitrosoindol-3-Yl)Ethanol |
|---|---|
| Synonyms | 2-(1-Nitroso-3-Indolyl)Ethanol; 1-Nitroso-1H-Indole-3-Ethanol; 1-Nitrosotryptophol |
| Molecular Structure |  |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 120314-14-9 |
| SMILES | C2=C(CCO)C1=CC=CC=C1[N]2N=O |
| InChI | 1S/C10H10N2O2/c13-6-5-8-7-12(11-14)10-4-2-1-3-9(8)10/h1-4,7,13H,5-6H2 |
| InChIKey | LPKIJQXIHVWSIQ-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.605°C at 760 mmHg (Cal.) |
| Flash point | 180.355°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Nitrosoindol-3-Yl)Ethanol |