Online Database of Chemicals from Around the World
|
CAS#: 62178-60-3 Product: Nitrosolandrin No suppilers available for the product. |
| Name | Nitrosolandrin |
|---|---|
| Synonyms | (2,3,4-Trimethylphenyl) N-Methyl-N-Nitroso-Carbamate; N-Methyl-N-Nitrosocarbamic Acid (2,3,4-Trimethylphenyl) Ester; N-Methyl-N-Nitroso-Carbamic Acid (2,3,4-Trimethylphenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 62178-60-3 |
| SMILES | C1=C(C(=C(C(=C1)OC(N(N=O)C)=O)C)C)C |
| InChI | 1S/C11H14N2O3/c1-7-5-6-10(9(3)8(7)2)16-11(14)13(4)12-15/h5-6H,1-4H3 |
| InChIKey | BOMIVRYJPJDQRT-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.57°C at 760 mmHg (Cal.) |
| Flash point | 144.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitrosolandrin |