Online Database of Chemicals from Around the World
| Name | 1-Chloro-2,4,5-Tris(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | 1-Chloro-2,4,5-tris-trifluoromethyl-benzene |
| Molecular Structure |  |
| Molecular Formula | C9H2ClF9 |
| Molecular Weight | 316.55 |
| CAS Registry Number | 120326-71-8 |
| SMILES | FC(F)(F)c1cc(c(cc1Cl)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C9H2ClF9/c10-6-2-4(8(14,15)16)3(7(11,12)13)1-5(6)9(17,18)19/h1-2H |
| InChIKey | KNTHVWLEGWINPK-UHFFFAOYSA-N |
| Density | 1.568g/cm3 (Cal.) |
|---|---|
| Boiling point | 160.155°C at 760 mmHg (Cal.) |
| Flash point | 69.648°C (Cal.) |
| Refractive index | 1.373 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2,4,5-Tris(Trifluoromethyl)Benzene |
