Online Database of Chemicals from Around the World
|
CAS#: 64295-03-0 Product: 5-Chloro-2,4,6-Tris(1-Aziridinyl)Pyrimidine No suppilers available for the product. |
| Name | 5-Chloro-2,4,6-Tris(1-Aziridinyl)Pyrimidine |
|---|---|
| Synonyms | 2,4,6-Tris(Azetidin-1-Yl)-5-Chloro-Pyrimidine; 2,4,6-Tris(1-Azetidinyl)-5-Chloropyrimidine; 5-Chloro-2,4,6-Triethyleneiminopyrimidine |
| Molecular Structure |  |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 |
| CAS Registry Number | 64295-03-0 |
| SMILES | C1(=NC(=C(C(=N1)N2CCC2)Cl)N3CCC3)N4CCC4 |
| InChI | 1S/C13H18ClN5/c14-10-11(17-4-1-5-17)15-13(19-8-3-9-19)16-12(10)18-6-2-7-18/h1-9H2 |
| InChIKey | IHDVJHWKYBIOBA-UHFFFAOYSA-N |
| Density | 1.412g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.001°C at 760 mmHg (Cal.) |
| Flash point | 262.844°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2,4,6-Tris(1-Aziridinyl)Pyrimidine |