Online Database of Chemicals from Around the World
(7E)-1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-7-Hexadecene
[CAS# 120464-27-9]
Identification
| Name |
(7E)-1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-7-Hexadecene |
| Synonyms |
1-(Perfluorohexyl)dec-1-ene; 1-(Perfluorohexyl)dec-1-ene 95%; MFCD00042350 |
|
| Molecular Structure |
 |
| Molecular Formula |
C16H19F13 |
| Molecular Weight |
458.30 |
| CAS Registry Number |
120464-27-9 |
| SMILES |
FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)/C=C/CCCCCCCC |
| InChI |
1S/C16H19F13/c1-2-3-4-5-6-7-8-9-10-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h9-10H,2-8H2,1H3/b10-9+ |
| InChIKey |
UFXJXRIUXCGTRG-MDZDMXLPSA-N |
|
Properties
| Density |
1.282g/cm3 (Cal.) |
| Boiling point |
276.61°C at 760 mmHg (Cal.) |
| Flash point |
112.669°C (Cal.) |
| Refractive index |
1.356 (Cal.) |
|
Safety Data
| Safety Description |
Irritant |
|
| Market Analysis Reports |
|
List of Reports Available for (7E)-1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-7-Hexadecene
|
|
|
Related Products
1,1,1,2,2,3,3,4... 2-[(4,4,5,5,6,6... 7,7,8,8,9,9,10,... 2,2,3,3,4,4,5,5... 2,2,3,3,4,4,5,5... 2,2,3,3,4,4,5,5... Tridecafluorohe... 2-(2,2,3,3,4,4,... 2,2,3,3,4,4,5,5... 1,1,1,2,2,3,3,4... 1,1,1,2,2,3,3,4... Tridecafluorohe... 1,1,2,2,3,3,4,4... 1,1,2,2,3,3,4,4... 4-(Tridecafluor... (Tridecafluoroh... 2-(Tridecafluor... [2-(Tridecafluo... 2-(1,1,2,2,3,3,... Tridecafluoro-N...