| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptyl Ester; Acrylic Acid 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptyl Ester; 1,1-Dihydroperfluoroheptyl Acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5F13O2 |
| Molecular Weight | 404.13 |
| CAS Registry Number | 559-11-5 |
| EINECS | 209-200-4 |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)OC(C=C)=O |
| InChI | 1S/C10H5F13O2/c1-2-4(24)25-3-5(11,12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h2H,1,3H2 |
| InChIKey | XJAVADKMAMZXPW-UHFFFAOYSA-N |
| Density | 1.535g/cm3 (Cal.) |
|---|---|
| Boiling point | 75-76°C (Expl.) |
| 182.195°C at 760 mmHg (Cal.) | |
| Flash point | 62.665°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptyl Acrylate |