| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Anastrozole EP Impurity G |
|---|---|
| Synonyms | 2,2'-[5-(4H-1,2,4-triazol-4-ylmethyl)-1,3-phenylene]bis(2-methylpropanenitrile) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 |
| CAS Registry Number | 120511-92-4 |
| EC Number | 689-793-8 |
| SMILES | CC(C)(C#N)C1=CC(=CC(=C1)CN2C=NN=C2)C(C)(C)C#N |
| Solubility | 68.39 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.580, Calc.* |
| Melting point | 187.64 °C |
| Boiling Point | 446.58 °C, 469.7±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 237.9±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H301-H351-H360-H361-H362 Details | ||||||||||||||||||||||||
| Safety Statements | P203-P260-P263-P264-P270-P280-P301+P316-P318-P321-P330-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Anastrozole EP Impurity G |