Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (-)-Anatoxin-A Fumarate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.23 |
| CAS Registry Number | 92142-32-0 |
| SMILES | [C@H]12N[C@H](CC1)CCC=C2C(=O)C |
| InChI | 1S/C10H15NO/c1-7(12)9-4-2-3-8-5-6-10(9)11-8/h4,8,10-11H,2-3,5-6H2,1H3/t8-,10-/m0/s1 |
| InChIKey | SGNXVBOIDPPRJJ-WPRPVWTQSA-N |
| Density | 1.037g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.995°C at 760 mmHg (Cal.) |
| Flash point | 124.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (-)-Anatoxin-A Fumarate |