| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 3,5-Disulfobenzoic Acid |
|---|---|
| Synonyms | 3,5-Disulphobenzoic Acid; Benzoic Acid, 3,5-Disulfo- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6O8S2 |
| Molecular Weight | 282.24 |
| CAS Registry Number | 121-48-2 |
| EINECS | 204-474-1 |
| SMILES | C1=C(C=C(C(O)=O)C=C1[S](=O)(=O)O)[S](=O)(=O)O |
| InChI | 1S/C7H6O8S2/c8-7(9)4-1-5(16(10,11)12)3-6(2-4)17(13,14)15/h1-3H,(H,8,9)(H,10,11,12)(H,13,14,15) |
| InChIKey | LZRAAMHXKXNHEF-UHFFFAOYSA-N |
| Density | 1.913g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,5-Disulfobenzoic Acid |