Online Database of Chemicals from Around the World
|
CAS#: 83929-52-6 Product: 3,5-disulfonato-Benzoate sodium salt (1:1) No suppilers available for the product. |
| Name | 3,5-disulfonato-Benzoate sodium salt (1:1) |
|---|---|
| Synonyms | sodium dihydrogen 3,5-disulphonatobenzoate |
| Molecular Structure |  |
| Molecular Formula | C7H3NaO8S2 |
| Molecular Weight | 302.21 |
| CAS Registry Number | 83929-52-6 |
| EINECS | 281-344-0 |
| SMILES | [Na+].O=S([O-])(=O)c1cc(cc(c1)S([O-])(=O)=O)C([O-])=O |
| InChI | 1S/C7H6O8S2.Na/c8-7(9)4-1-5(16(10,11)12)3-6(2-4)17(13,14)15;/h1-3H,(H,8,9)(H,10,11,12)(H,13,14,15);/q;+1/p-3 |
| InChIKey | IUPSWFMSAKEOQP-UHFFFAOYSA-K |
| Market Analysis Reports |
| List of Reports Available for 3,5-disulfonato-Benzoate sodium salt (1:1) |