tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate
[CAS# 1210348-34-7]

Identification

• Classification: Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives
• Name: tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate
• Molecular Formula: C₁₄H₂₇N₃O₃.C₂H₂O₄
• Molecular Weight: 375.42
• CAS Registry Number: 1210348-34-7
• EC Number: 952-232-5
• SMILES: CC(C)(C)OC(=O)N[C@@H]1C[C@H](CC[C@@H]1N)C(=O)N(C)C.C(=O)(C(=O)O)O

Safety Data

• Hazard Symbols: GHS07 Warning
• Risk Statements: H302+H312-H302-H312
• Safety Statements: P264-P270-P280-P301+P317-P302+P352-P317-P321-P330-P362+P364-P501

Hazard Classification

Hazard	Class	Category Code	Hazard Statement
Acute toxicity	Acute Tox.	4	H302
Acute toxicity	Acute Tox.	4	H312

Discovery and Applications

tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate is a complex organic compound that has attracted attention in the field of pharmaceutical and medicinal chemistry due to its structural features and potential bioactivity. This compound is an amino acid derivative featuring a cyclohexane ring, which plays a crucial role in its interaction with biological systems. The chemical structure consists of a tert-butyl carbamate group, an amino group, and a dimethylamino-carbonyl group attached to the cyclohexyl ring. The oxalate salt form further enhances its stability, making it suitable for use in various research applications.

The discovery of this compound is part of a broader effort to design and synthesize novel molecules with potential therapeutic properties. The modification of the cyclohexane ring with specific functional groups, such as the dimethylamino-carbonyl and amino groups, allows for the tuning of the compound's properties, including its solubility, bioavailability, and biological activity. The presence of the tert-butyl group contributes to the molecule's steric properties, which can influence its interaction with target proteins or enzymes.

One of the main applications of tert-butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate lies in its potential as a pharmaceutical intermediate or precursor. Its unique combination of functional groups makes it a valuable starting material for the synthesis of more complex compounds with specific pharmacological activities. The cyclohexane structure, in particular, can be used as a scaffold for the development of drugs targeting various diseases, including neurological disorders, cancer, and metabolic diseases. The modification of the amino acid derivative can lead to the development of molecules that interact with receptors, enzymes, or transporters, thus providing a range of potential therapeutic applications.

Furthermore, the compound could be explored for its potential role as an enzyme inhibitor or receptor antagonist. The dimethylamino-carbonyl group may play a role in enhancing the molecule's binding affinity to specific biological targets, while the amino group may contribute to interactions with protein binding sites. These interactions can be fine-tuned to develop compounds that either inhibit or activate specific pathways, making them useful for the treatment of conditions such as cancer, inflammatory diseases, or neurological disorders. Additionally, the use of the oxalate salt form helps improve the solubility and stability of the compound, making it easier to administer in experimental or clinical settings.

The compound's properties also make it a candidate for use in medicinal chemistry research focused on optimizing drug delivery systems. The structure of tert-butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate could serve as a building block for the design of prodrugs or other drug formulations that allow for more controlled release and targeted action. This could be particularly valuable in the development of drugs for chronic conditions or diseases where prolonged drug release is necessary for effective treatment.

In addition to its pharmaceutical applications, the compound may also find use in academic research, particularly in studies related to enzyme catalysis, protein binding, and molecular interactions. Researchers can explore how variations in the structural features of this compound influence its biological activity, providing insights into the design of future drug candidates.

In summary, tert-butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate is a promising compound with significant potential in drug development and medicinal chemistry. Its unique structural features make it an attractive candidate for the design of new therapeutics targeting a variety of diseases. Continued research into its properties and applications could lead to the development of novel drugs with improved efficacy and specificity.

References

none