| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-(4-Nitrophenyl)-L-Proline |
|---|---|
| Synonyms | N-(p-nitrophenyl)-(L)-proline |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.22 |
| CAS Registry Number | 122092-18-6 |
| SMILES | C1C[C@H](N(C1)C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
| InChI | 1S/C11H12N2O4/c14-11(15)10-2-1-7-12(10)8-3-5-9(6-4-8)13(16)17/h3-6,10H,1-2,7H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | RKUGUORNGRELOH-JTQLQIEISA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.9±40.0°C at 760 mmHg (Cal.) |
| Flash point | 242.8±27.3°C (Cal.) |
| Refractive index | 1.621 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Paolo Lo Meo, Francesca D'Anna, Serena Riela, Michelangelo Gruttadauria and Renato Noto. Spectrophotometric study on the thermodynamics of binding of a- and ß-cyclodextrin towards some p-nitrobenzene derivatives, Org. Biomol. Chem., 2003, 1, 1584. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(4-Nitrophenyl)-L-Proline |