Online Database of Chemicals from Around the World

1-(2-nitrophenyl)piperidine-4-carboxylic Acid
[CAS 438192-02-0]

List of Suppliers
Zhengzhou Kingorgchem Chemical Technology Co., Ltd. China
www.kingorgchem.com
+86 (371) 6551-1006
+86 (371) 6575-6965
sales@kingorgchem.com
QQ Chat
WeChat: 18625597674
Chemical manufacturer since 2015
chemBlink Standard supplier since 2016

Identification
ClassificationOrganic raw materials >> Aryl compounds
Name1-(2-nitrophenyl)piperidine-4-carboxylic Acid
Molecular Structure1-(2-nitrophenyl)piperidine-4-carboxylic Acid molecular structure (CAS 438192-02-0)
Molecular FormulaC12H14N2O4
Molecular Weight250.25
CAS Registry Number438192-02-0
EC Number974-069-9
SMILESC1CN(CCC1C(=O)O)C2=CC=CC=C2[N+](=O)[O-]
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
SDSAvailable
up Discovery and Applications
1-(2-Nitrophenyl)piperidine-4-carboxylic acid is a notable compound in organic chemistry, known for its unique structure and diverse applications. This compound features a piperidine ring with a carboxylic acid group and a nitro group attached to a phenyl ring, which significantly impacts its chemical behavior and utility.

The discovery of 1-(2-nitrophenyl)piperidine-4-carboxylic acid emerged from efforts to develop novel molecules with potential therapeutic and synthetic applications. The presence of the nitro group on the phenyl ring introduces strong electron-withdrawing properties, which affect the compound's reactivity and interaction with other chemical entities.

In pharmaceutical research, 1-(2-nitrophenyl)piperidine-4-carboxylic acid has attracted interest due to its potential as a precursor or intermediate in the synthesis of bioactive molecules. The piperidine ring is a common structural motif in many drugs, and the incorporation of the nitro group can modify the biological activity of the resulting compounds. This makes it valuable in the development of new pharmaceutical agents with enhanced or specific activity profiles.

In addition to its role in drug development, 1-(2-nitrophenyl)piperidine-4-carboxylic acid is used in the synthesis of complex organic molecules. Its functional groups facilitate various chemical transformations, including coupling reactions and functionalization processes. The compound's ability to serve as a versatile building block makes it important in the synthesis of more complex structures, which are crucial in materials science and organic synthesis.

Moreover, the compound is employed in research to study the effects of substituents on the reactivity and properties of piperidine derivatives. By analyzing how different groups, such as the nitro group, influence the behavior of the piperidine ring, researchers can gain insights into designing molecules with specific characteristics.

Overall, 1-(2-nitrophenyl)piperidine-4-carboxylic acid is a significant compound in organic chemistry with valuable applications in drug discovery, synthetic chemistry, and material science. Its distinctive structure and reactivity make it a useful tool for developing new compounds and studying chemical behavior.
Market Analysis Reports
Related Products
4-(2-Nitropheny...  4-(3-Nitropheny...  N-(4-Nitropheny...  N-(3-Nitropheny...  N-(4-Nitropheny...  N-(2-Nitropheny...  N-(3-Nitropheny...  N-(2-Nitropheny...  3-Nitrophenyl 3...  1-(4-Nitropheny...  4-(4-nitropheny...  4-(4-Nitropheny...  alpha-(4-Nitrop...  1-(4-Nitropheny...  1-(4-Nitropheny...  [1-(2-Nitro-phe...  (2-Nitrophenyl)...  3-Nitro-N-[1-ph...  2-(4-Nitropheny...  1-(4-Nitropheny...