| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Enamine Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Name | 2-[4-(Methylsulfonyl)Phenyl]-Imidazo[1,2-a]Pyridine |
|---|---|
| Synonyms | 2-(4-Mesylphenyl)Imidazo[1,2-A]Pyridine; Zolimidine; Zolimidine [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.32 |
| CAS Registry Number | 1222-57-7 |
| EINECS | 214-947-4 |
| SMILES | C2=C(C1=CC=C(C=C1)[S](C)(=O)=O)N=C3C=CC=C[N]23 |
| InChI | 1S/C14H12N2O2S/c1-19(17,18)12-7-5-11(6-8-12)13-10-16-9-3-2-4-14(16)15-13/h2-10H,1H3 |
| InChIKey | VSLIUWLPFRVCDL-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| (1) | Kasiviswanadharaju Pericherla, Pinku Kaswan, Poonam Khedar, Bharti Khungar, Keykavous Parang and Anil Kumar. Copper catalyzed tandem oxidative C–H amination/cyclizations: Direct access to imidazo[1,2-a]pyridines, RSC Advances, 2013, . |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[4-(Methylsulfonyl)Phenyl]-Imidazo[1,2-a]Pyridine |