Online Database of Chemicals from Around the World
|
CAS#: 12226-04-9 Product: Reactivered No5 No suppilers available for the product. |
| Name | Reactivered No5 |
|---|---|
| Synonyms | N-[(4,6-Dichloro-1,3,5-Triazin-2-Yl)Methyl]-6-(2-Naphthylazo)Naphthalen-2-Amine; N-[(4,6-Dichloro-1,3,5-Triazin-2-Yl)Methyl]-6-(2-Naphthylazo)-2-Naphthalenamine; (4,6-Dichloro-S-Triazin-2-Yl)Methyl-[6-(2-Naphthylazo)-2-Naphthyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C24H16Cl2N6 |
| Molecular Weight | 459.34 |
| CAS Registry Number | 12226-04-9 |
| SMILES | C2=C(NCC1=NC(=NC(=N1)Cl)Cl)C=CC3=C2C=CC(=C3)N=NC5=CC4=C(C=CC=C4)C=C5 |
| InChI | 1S/C24H16Cl2N6/c25-23-28-22(29-24(26)30-23)14-27-19-8-6-18-13-21(10-7-17(18)11-19)32-31-20-9-5-15-3-1-2-4-16(15)12-20/h1-13,27H,14H2 |
| InChIKey | KJPUOJVUFLEJRP-UHFFFAOYSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 765.131°C at 760 mmHg (Cal.) |
| Flash point | 416.536°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Reactivered No5 |