Online Database of Chemicals from Around the World
|
CAS#: 123016-73-9 Product: (1-Nitrosopiperidin-2-Yl) Dihydrogen Phosphate No suppilers available for the product. |
| Name | (1-Nitrosopiperidin-2-Yl) Dihydrogen Phosphate |
|---|---|
| Synonyms | (1-Nitroso-2-Piperidyl) Dihydrogen Phosphate; (1-Nitroso-2-Piperidinyl) Dihydrogen Phosphate; 1-Hydroxy-N-Nitrosopiperidine Phosphate Ester |
| Molecular Structure |  |
| Molecular Formula | C5H11N2O5P |
| Molecular Weight | 210.13 |
| CAS Registry Number | 123016-73-9 |
| SMILES | O=[P](O)(O)OC1N(CCCC1)N=O |
| InChI | 1S/C5H11N2O5P/c8-6-7-4-2-1-3-5(7)12-13(9,10)11/h5H,1-4H2,(H2,9,10,11) |
| InChIKey | ZOYHRFIGGHJHIX-UHFFFAOYSA-N |
| Density | 1.81g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.643°C at 760 mmHg (Cal.) |
| Flash point | 241.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Nitrosopiperidin-2-Yl) Dihydrogen Phosphate |