Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Nitroso-L-Proline Ethyl Ester |
|---|---|
| Synonyms | (2S)-1-Nitroso-2-Pyrrolidinecarboxylic Acid Ethyl Ester; (2S)-1-Nitrosopyrrolidine-2-Carboxylic Acid Ethyl Ester; L-Proline, 1-Nitroso-, Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 17431-20-8 |
| SMILES | [C@H]1(C(=O)OCC)N(CCC1)N=O |
| InChI | 1S/C7H12N2O3/c1-2-12-7(10)6-4-3-5-9(6)8-11/h6H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | CPURSCKAPPWVBT-LURJTMIESA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.335°C at 760 mmHg (Cal.) |
| Flash point | 130.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitroso-L-Proline Ethyl Ester |