Online Database of Chemicals from Around the World
|
CAS#: 123064-74-4 Product: 22-And-Echitamine No suppilers available for the product. |
| Name | 22-And-Echitamine |
|---|---|
| Synonyms | 22-O-Acetyl-N(B)-Demethylechitamine |
| Molecular Structure |  |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.48 |
| CAS Registry Number | 123064-74-4 |
| SMILES | C5=C4C12C3(N(CC1)CC(/C(C2(C(OC)=O)COC(=O)C)CC3O)=C\C)NC4=CC=C5 |
| InChI | 1S/C23H28N2O5/c1-4-15-12-25-10-9-22-16-7-5-6-8-18(16)24-23(22,25)19(27)11-17(15)21(22,20(28)29-3)13-30-14(2)26/h4-8,17,19,24,27H,9-13H2,1-3H3/b15-4+ |
| InChIKey | RVBBDUUBDPKZFR-SYZQJQIISA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.796°C at 760 mmHg (Cal.) |
| Flash point | 295.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 22-And-Echitamine |