Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-2-Propanyl Pentacyclo[4.2.0.02,5.03,8.04,7]Oct-1-Ylcarbamate |
|---|---|
| Synonyms | tert-butyl cuban-1-ylcarbamate |
| Molecular Structure | ![CAS#: 124783-63-7， 2-Methyl-2-Propanyl Pentacyclo[4.2.0.0<Sup>2,5</Sup>.0<Sup>3,8</Sup>.0<Sup>4,7</Sup>]Oct-1-Ylcarbamate](/moreStructures/124783-63-7.gif) |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 124783-63-7 |
| SMILES | CC(C)(C)OC(=O)NC54C1C3C2C1C5C2C34 |
| InChI | 1S/C13H17NO2/c1-12(2,3)16-11(15)14-13-8-5-4-6(8)10(13)7(4)9(5)13/h4-10H,1-3H3,(H,14,15) |
| InChIKey | NMAHXQAVLRHSCZ-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.12°C at 760 mmHg (Cal.) |
| Flash point | 146.194°C (Cal.) |
| Refractive index | 1.61 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl Pentacyclo[4.2.0.02,5.03,8.04,7]Oct-1-Ylcarbamate |