Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Methyl-2-Propanyl Pentachlorophenyl Carbonate |
|---|---|
| Synonyms | t-Butylpentachlorophenyl carbonate; tert-Butyl 2,3,4,5,6-pentachlorophenyl carbonate # |
| Molecular Structure |  |
| Molecular Formula | C11H9Cl5O3 |
| Molecular Weight | 366.45 |
| CAS Registry Number | 18942-25-1 |
| SMILES | Clc1c(OC(=O)OC(C)(C)C)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | 1S/C11H9Cl5O3/c1-11(2,3)19-10(17)18-9-7(15)5(13)4(12)6(14)8(9)16/h1-3H3 |
| InChIKey | GHBRKMLMVFKZKW-UHFFFAOYSA-N |
| Density | 1.51g/cm3 (Cal.) |
|---|---|
| Melting point | 117°C (Expl.) |
| Boiling point | 411.736°C at 760 mmHg (Cal.) |
| Flash point | 158.944°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl Pentachlorophenyl Carbonate |