Online Database of Chemicals from Around the World
|
CAS#: 125247-70-3 Product: 7-O-Isopropyl fangchinoline No suppilers available for the product. |
| Name | 7-O-Isopropyl fangchinoline |
|---|---|
| Synonyms | 7-O-Isopropyl Fangchinoline |
| Molecular Structure |  |
| Molecular Formula | C40H46N2O6 |
| Molecular Weight | 650.81 |
| CAS Registry Number | 125247-70-3 |
| SMILES | [C@@H]16N(CCC2=C1C(=C(OC(C)C)C(=C2)OC)OC3=CC4=C(C=C3OC)CCN([C@H]4CC7=CC=C(OC5=CC(=CC=C5OC)C6)C=C7)C)C |
| InChI | 1S/C40H46N2O6/c1-24(2)46-39-37(45-7)22-28-15-17-42(4)32-19-26-10-13-33(43-5)35(20-26)47-29-11-8-25(9-12-29)18-31-30-23-36(48-40(39)38(28)32)34(44-6)21-27(30)14-16-41(31)3/h8-13,20-24,31-32H,14-19H2,1-7H3/t31-,32-/m0/s1 |
| InChIKey | BWAFJYRTDWVKOE-ACHIHNKUSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 724.066°C at 760 mmHg (Cal.) |
| Flash point | 174.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-O-Isopropyl fangchinoline |