Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Isopropyl 4-Formamidobenzoate |
|---|---|
| Synonyms | isopropyl 4-formamidobenzoate |
| Molecular Structure |  |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 205810-19-1 |
| SMILES | O=CNc1ccc(cc1)C(=O)OC(C)C |
| InChI | 1S/C11H13NO3/c1-8(2)15-11(14)9-3-5-10(6-4-9)12-7-13/h3-8H,1-2H3,(H,12,13) |
| InChIKey | UCPRWIKYZBFPJJ-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.349°C at 760 mmHg (Cal.) |
| Flash point | 179.595°C (Cal.) |
| Refractive index | 1.555 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl 4-Formamidobenzoate |