| NANJING TOMMLAB PHARMATECH Co., LTD | China | Inquire | ||
|---|---|---|---|---|
![]() | www.tommlab.com | |||
![]() | +86 (025) 8616-1360 | |||
![]() | tommlab@163.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2020 | ||||
| Name | 2-Methyl-2-propanyl (4-acetyl-3-hydroxyphenyl)carbamate |
|---|---|
| Synonyms | tert-butyl N-(4-acetyl-3-hydroxyphenyl)carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 |
| CAS Registry Number | 1258868-22-2 |
| SMILES | CC(=O)C1=C(C=C(C=C1)NC(=O)OC(C)(C)C)O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.567, Calc.* |
| Boiling Point | 338.7±32.0 °C (760 mmHg), Calc.* |
| Flash Point | 158.6±25.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl (4-acetyl-3-hydroxyphenyl)carbamate |