|
CAS#: 850877-60-0 Product: 2-Methyl-2-propanyl 5-acetyl-1,3-dihydro-2H-isoindole-2-carboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 5-acetyl-1,3-dihydro-2H-isoindole-2-carboxylate |
|---|---|
| Synonyms | 2-Boc-5-Acetyl-isoindoline; 5-Acetyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 |
| CAS Registry Number | 850877-60-0 |
| SMILES | CC(=O)c1ccc2c(c1)CN(C2)C(=O)OC(C)(C)C |
| InChI | 1S/C15H19NO3/c1-10(17)11-5-6-12-8-16(9-13(12)7-11)14(18)19-15(2,3)4/h5-7H,8-9H2,1-4H3 |
| InChIKey | CUIPBGJZWSDLTK-UHFFFAOYSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.383°C at 760 mmHg (Cal.) |
| Flash point | 194.131°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 5-acetyl-1,3-dihydro-2H-isoindole-2-carboxylate |