Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Nitro-5-Vinylpyridine |
|---|---|
| Synonyms | 2-nitro-5-vinylpyridine |
| Molecular Structure |  |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 125889-39-6 |
| SMILES | C=Cc1ccc(nc1)[N+](=O)[O-] |
| InChI | 1S/C7H6N2O2/c1-2-6-3-4-7(8-5-6)9(10)11/h2-5H,1H2 |
| InChIKey | YTCBXYKWOQWDLZ-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.196°C at 760 mmHg (Cal.) |
| Flash point | 106.929°C (Cal.) |
| Refractive index | 1.611 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-5-Vinylpyridine |