Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Nitro-5-vinylphenol |
|---|---|
| Synonyms | 2-nitro-5-vinylphenol |
| Molecular Structure |  |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 |
| CAS Registry Number | 97105-09-4 |
| SMILES | C=Cc1ccc(c(c1)O)[N+](=O)[O-] |
| InChI | 1S/C8H7NO3/c1-2-6-3-4-7(9(11)12)8(10)5-6/h2-5,10H,1H2 |
| InChIKey | NNGIHPSIRLXGSE-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.32°C at 760 mmHg (Cal.) |
| Flash point | 105.908°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-5-vinylphenol |