Online Database of Chemicals from Around the World
|
CAS#: 126-61-4 Product: 1-Dimethoxyphosphorylethenyl Diethyl Phosphate No suppilers available for the product. |
| Name | 1-Dimethoxyphosphorylethenyl Diethyl Phosphate |
|---|---|
| Synonyms | 1-Dimethoxyphosphorylvinyl Diethyl Phosphate; Phosphoric Acid 1-Dimethoxyphosphorylvinyl Diethyl Ester; Ai3-24953 |
| Molecular Structure |  |
| Molecular Formula | C8H18O7P2 |
| Molecular Weight | 288.17 |
| CAS Registry Number | 126-61-4 |
| SMILES | C(O[P](OC([P](=O)(OC)OC)=C)(=O)OCC)C |
| InChI | 1S/C8H18O7P2/c1-6-13-17(10,14-7-2)15-8(3)16(9,11-4)12-5/h3,6-7H2,1-2,4-5H3 |
| InChIKey | FJJRBYAELMSSPD-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.309°C at 760 mmHg (Cal.) |
| Flash point | 164.328°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Dimethoxyphosphorylethenyl Diethyl Phosphate |