Online Database of Chemicals from Around the World
| Name | 1-Dimethoxyphosphorylethenyl Dimethyl Phosphate |
|---|---|
| Synonyms | 1-Dimethoxyphosphorylvinyl Dimethyl Phosphate; Phosphoric Acid 1-Dimethoxyphosphorylvinyl Dimethyl Ester; 4-01-00-03423 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C6H14O7P2 |
| Molecular Weight | 260.12 |
| CAS Registry Number | 3328-33-4 |
| SMILES | CO[P](C(O[P](=O)(OC)OC)=C)(=O)OC |
| InChI | 1S/C6H14O7P2/c1-6(14(7,9-2)10-3)13-15(8,11-4)12-5/h1H2,2-5H3 |
| InChIKey | XOKPUBSZNXLEBS-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.381°C at 760 mmHg (Cal.) |
| Flash point | 144.54°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Dimethoxyphosphorylethenyl Dimethyl Phosphate |
