| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | Fosfomycin Trometamol EP Impurity D |
|---|---|
| Synonyms | [2-[[2-[2-amino-3-hydroxy-2-(hydroxymethyl)propoxy]-1-hydroxypropyl]-hydroxyphosphoryl]oxy-1-hydroxypropyl]phosphonic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H25NO11P2 |
| Molecular Weight | 397.25 |
| CAS Registry Number | 1262243-12-8 |
| SMILES | CC(C(O)P(=O)(O)OC(C)C(O)P(=O)(O)O)OCC(CO)(CO)N |
| Density | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.571, Calc.* |
| Boiling Point | 755.0±70.0 °C (760 mmHg), Calc.* |
| Flash Point | 410.4±35.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Fosfomycin Trometamol EP Impurity D |