Online Database of Chemicals from Around the World
| Name | 4-Chloro-1-Nitrosoindole |
|---|---|
| Synonyms | 4-Chloro-1-Nitroso-Indole; 1H-Indole, 4-Chloro-1-Nitroso-; 4-Chloro-1-Nitroso-1H-Indole |
| Molecular Structure |  |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 |
| CAS Registry Number | 126590-88-3 |
| SMILES | C1=CC2=C([N]1N=O)C=CC=C2Cl |
| InChI | 1S/C8H5ClN2O/c9-7-2-1-3-8-6(7)4-5-11(8)10-12/h1-5H |
| InChIKey | HIJZOLDFHYLQHH-UHFFFAOYSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.316°C at 760 mmHg (Cal.) |
| Flash point | 142.684°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-1-Nitrosoindole |
