Online Database of Chemicals from Around the World
|
CAS#: 6490-99-9 Product: 4-Chloro-3-nitrosalicylanilide No suppilers available for the product. |
| Name | 4-Chloro-3-nitrosalicylanilide |
|---|---|
| Synonyms | N-(4-Chlorophenyl)-2-Hydroxy-3-Nitro-Benzamide; 4-12-00-01220 (Beilstein Handbook Reference); Ai3-51402 |
| Molecular Structure |  |
| Molecular Formula | C13H9ClN2O4 |
| Molecular Weight | 292.68 |
| CAS Registry Number | 6490-99-9 |
| SMILES | C1=C(C(=C(C=C1)[N+]([O-])=O)O)C(=O)NC2=CC=C(C=C2)Cl |
| InChI | 1S/C13H9ClN2O4/c14-8-4-6-9(7-5-8)15-13(18)10-2-1-3-11(12(10)17)16(19)20/h1-7,17H,(H,15,18) |
| InChIKey | UOHLBUBEMXVTMQ-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.995°C at 760 mmHg (Cal.) |
| Flash point | 170.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-3-nitrosalicylanilide |