|
CAS#: 127060-92-8 Product: (2R,3S)-2-Ammonio-3-Hydroxy-2-Methylbutanoate No suppilers available for the product. |
| Name | (2R,3S)-2-Ammonio-3-Hydroxy-2-Methylbutanoate |
|---|---|
| Synonyms | (2R,3S)-2-amino-3-hydroxy-2-methylbutanoic acid; (2R,3S)-3-HYDROXY-D-ISOVALINE; ZINC04285771 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 |
| CAS Registry Number | 127060-92-8 |
| SMILES | [O-]C(=O)[C@@]([NH3+])(C)[C@@H](O)C |
| InChI | 1S/C5H11NO3/c1-3(7)5(2,6)4(8)9/h3,7H,6H2,1-2H3,(H,8,9)/t3-,5+/m0/s1 |
| InChIKey | NWZTXAMTDLRLFP-WVZVXSGGSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.288°C at 760 mmHg (Cal.) |
| Flash point | 145.691°C (Cal.) |
| Refractive index | 1.503 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S)-2-Ammonio-3-Hydroxy-2-Methylbutanoate |